Products 2012-73-9

CAS 2012-73-9 is the registry number for 2-Methyl-2-[4-(1-methyl-1-phenylethyl)phenoxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-methyl-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoic acid (CAS 2012-73-9) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: 2-methyl-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoic acid. InChIKey: MGQNICQOOANLCD-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22O3
Molecular weight298.4 g/mol
IUPAC name2-methyl-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoic acid
InChIKeyMGQNICQOOANLCD-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)OC(C)(C)C(=O)O

Computed by PubChem (NCBI)