CAS 648414-59-9 is the registry number for (3S,4S)-3,4-Bis(benzyloxy)cyclopentanol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(3S,4S)-3,4-bis(phenylmethoxy)cyclopentan-1-ol (CAS 648414-59-9) is a chemical compound with the molecular formula C19H22O3 and a molecular weight of 298.4 g/mol. IUPAC name: trans-(3S,4S)-3,4-bis(phenylmethoxy)cyclopentan-1-ol. InChIKey: GBZURZUCOQHUEB-OALUTQOASA-N.
| Molecular formula | C19H22O3 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | trans-(3S,4S)-3,4-bis(phenylmethoxy)cyclopentan-1-ol |
| InChIKey | GBZURZUCOQHUEB-OALUTQOASA-N |
| SMILES | C1[C@@H]([C@H](CC1O)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)