CAS 79015-49-9 appears in our catalog under these names: Anthracene–1,5–diamine, Anthracene-1,5-diamine 97%, 1,5-Anthracenediamine, 98%, 98%, Anthracene-1,5-diamine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
Anthracene-1,5-diamine (CAS 79015-49-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: anthracene-1,5-diamine. InChIKey: HRDWUZRHCJPOFA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | anthracene-1,5-diamine |
| InChIKey | HRDWUZRHCJPOFA-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=CC=C3N)C=C2C(=C1)N |
Computed by PubChem (NCBI)