CAS 791017-12-4 appears in our catalog under these names: 3-Fluoro-2,2-dimethyl-3-phenylpropanoic acid, 95%, 3-Fluoro-2,2-dimethyl-3-phenylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-fluoro-2,2-dimethyl-3-phenylpropanoic acid (CAS 791017-12-4) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: 3-fluoro-2,2-dimethyl-3-phenylpropanoic acid. InChIKey: HRNNRRFJUGQSJL-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 3-fluoro-2,2-dimethyl-3-phenylpropanoic acid |
| InChIKey | HRNNRRFJUGQSJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)