CAS 791594-81-5 appears in our catalog under these names: 2-Chloro-5,7-dimethylbenzo(d)thiazole, 97%, 2-Chloro-5,7-dimethyl-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 50mg, 0,5g.
2-chloro-5,7-dimethyl-1,3-benzothiazole (CAS 791594-81-5) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 2-chloro-5,7-dimethyl-1,3-benzothiazole. InChIKey: UMPCQBBRKCVELL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 2-chloro-5,7-dimethyl-1,3-benzothiazole |
| InChIKey | UMPCQBBRKCVELL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(S2)Cl)C |
Computed by PubChem (NCBI)