Products 79183-65-6
CAS 79183-65-6 appears in our catalog under these names: 7-Ethylisatin, 95%, 7–Ethyl–1H–indole–2，3–dione, 7-Ethylindoline-2,3-dione 95%, 7-Ethylindoline-2,3-dione, 95%, 95%, 7-Ethyl-1H-indole-2,3-dione, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 500mg, 250mg.
7-ethyl-1H-indole-2,3-dione (CAS 79183-65-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 7-ethyl-1H-indole-2,3-dione. InChIKey: YMZGAPGIOFRUFU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 7-ethyl-1H-indole-2,3-dione |
| InChIKey | YMZGAPGIOFRUFU-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
7-ethyl-2,3-dihydro-1H-indole-2,3-dione, 7-Ethylisatin, 7-Ethylindoline-2,3-dione, 7-ethyl-1H-indole-2,3-dione, 1H-Indole-2,3-dione,7-ethyl-, 1H-Indole-2,3-dione, 7-ethyl-, 7-Ethyl-1H-indole-2,3-dione >98%, YMZGAPGIOFRUFU-UHFFFAOYSA-N, 7-ethyl-1H-benzo[d]azoline-2,3-dione, 7-Ethyl-1h-indole-2,3-dione;7-Ethylisatin;