Products 79233-72-0
CAS 79233-72-0 appears in our catalog under these names: tert-Butyl pyridine-2-carboxylate, 98%, tert-Butyl pyridine-2-carboxylate, tert-Butyl pyridine-2-carboxylate 98%, tert-Butyl pyridine-2-carboxylate, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
Tert-butyl pyridine-2-carboxylate (CAS 79233-72-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: tert-butyl pyridine-2-carboxylate. InChIKey: KNLKRAUJQBLECR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | tert-butyl pyridine-2-carboxylate |
| InChIKey | KNLKRAUJQBLECR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC=N1 |
Computed by PubChem (NCBI)