CAS 793727-49-8 appears in our catalog under these names: 2-Hydrazino-4,7,8-trimethylquinoline, 95%, 2-Hydrazinyl-4,7,8-trimethylquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(4,7,8-trimethylquinolin-2-yl)hydrazine (CAS 793727-49-8) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: (4,7,8-trimethylquinolin-2-yl)hydrazine. InChIKey: LPDWOEAWNMGOAO-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | (4,7,8-trimethylquinolin-2-yl)hydrazine |
| InChIKey | LPDWOEAWNMGOAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)NN)C)C |
Computed by PubChem (NCBI)