Products 79473-21-5
CAS 79473-21-5 is the registry number for N-(N-Boc-D-alaninyl)-D-alanine. Offered by: TRC. Available pack sizes: 10g.
(2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid (CAS 79473-21-5) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid. InChIKey: BZNDDHWTEVCBAD-RNFRBKRXSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid |
| InChIKey | BZNDDHWTEVCBAD-RNFRBKRXSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)