CAS 795290-86-7 appears in our catalog under these names: N-[4-(2-Chloroacetyl)phenyl]-2,2-dimethylpropanamide, 95%, N-(4-(2-Chloroacetyl)phenyl)pivalamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
N-[4-(2-chloroacetyl)phenyl]-2,2-dimethylpropanamide (CAS 795290-86-7) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: N-[4-(2-chloroacetyl)phenyl]-2,2-dimethylpropanamide. InChIKey: JPRPQXWYQYKBOO-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | N-[4-(2-chloroacetyl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | JPRPQXWYQYKBOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=C(C=C1)C(=O)CCl |
Computed by PubChem (NCBI)