CAS 79562-49-5 appears in our catalog under these names: 1,3-Difluoro-2-methyl-4-nitrobenzene 97%, 1,3-Difluoro-2-methyl-4-nitrobenzene, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1,3-difluoro-2-methyl-4-nitrobenzene (CAS 79562-49-5) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 1,3-difluoro-2-methyl-4-nitrobenzene. InChIKey: AVWNNVJXXMKAPB-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 1,3-difluoro-2-methyl-4-nitrobenzene |
| InChIKey | AVWNNVJXXMKAPB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)