Products 79600-87-6
CAS 79600-87-6 appears in our catalog under these names: 4-Phenyl-1h-pyrrole-2-carboxylic acid, 95%, 4-Phenyl-1H-pyrrole-2-carboxylic acid, 97%, 4-Phenyl-1H-pyrrole-2-carboxylic acid, 4-Phenyl-1H-pyrrole-2-carboxylic acid, 97%, 97%, 4-phenyl-1H-pyrrole-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 0,5g, 50mg, 100mg.
4-phenyl-1H-pyrrole-2-carboxylic acid (CAS 79600-87-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 4-phenyl-1H-pyrrole-2-carboxylic acid. InChIKey: USTKWYVBYDXQPG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 4-phenyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | USTKWYVBYDXQPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=C2)C(=O)O |
Computed by PubChem (NCBI)