CAS 796106-49-5 appears in our catalog under these names: 2-(Chloromethyl)-5-(2,5-dimethyl-3-furyl)-1,3,4-oxadiazole, 95%, 2-(Chloromethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2-(chloromethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole (CAS 796106-49-5) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 2-(chloromethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole. InChIKey: FABWAGDIYMEXOV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazole |
| InChIKey | FABWAGDIYMEXOV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)