Products 79652-35-0
CAS 79652-35-0 appears in our catalog under these names: Ethyl 3-formyl-5-methyl-1H-indole-2-carboxylate, 95%, Ethyl 3–formyl–5–methyl–1H–indole–2–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 3-formyl-5-methyl-1H-indole-2-carboxylate (CAS 79652-35-0) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 3-formyl-5-methyl-1H-indole-2-carboxylate. InChIKey: DOQMHUCEKZOCLX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 3-formyl-5-methyl-1H-indole-2-carboxylate |
| InChIKey | DOQMHUCEKZOCLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=CC(=C2)C)C=O |
Computed by PubChem (NCBI)