CAS 79686-36-5 appears in our catalog under these names: 3-(Bromomethyl)benzene-1-sulfonyl fluoride, 95%, 95%, 3-(BROMOMETHYL)BENZENE-1-SULFONYL FLUORIDE, 98%, 3-(Bromomethyl)benzene-1-sulfonyl fluoride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(bromomethyl)benzenesulfonyl fluoride (CAS 79686-36-5) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 3-(bromomethyl)benzenesulfonyl fluoride. InChIKey: IANRVXMUYOCEIY-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFO2S |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 3-(bromomethyl)benzenesulfonyl fluoride |
| InChIKey | IANRVXMUYOCEIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)CBr |
Computed by PubChem (NCBI)