Products 79909-92-5
CAS 79909-92-5 appears in our catalog under these names: Methyl 4-amino-2,6-dimethylbenzoate, 95%, Methyl 4–amino–2，6–dimethylbenzoate, Methyl 4-amino-2,6-dimethylbenzoate, Methyl 4-amino-2,6-dimethylbenzoate 97%, Methyl 4-amino-2,6-dimethylbenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 2,5g, 10g.
Methyl 4-amino-2,6-dimethylbenzoate (CAS 79909-92-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 4-amino-2,6-dimethylbenzoate. InChIKey: XSDROOHFZHGXIX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 4-amino-2,6-dimethylbenzoate |
| InChIKey | XSDROOHFZHGXIX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)C)N |
Computed by PubChem (NCBI)