CAS 80020-14-0 is the registry number for 4-(Piperidine-1-carbonyl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(piperidine-1-carbonyl)benzaldehyde (CAS 80020-14-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 4-(piperidine-1-carbonyl)benzaldehyde. InChIKey: UITGRKOJUBJCHX-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 4-(piperidine-1-carbonyl)benzaldehyde |
| InChIKey | UITGRKOJUBJCHX-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)