CAS 800375-15-9 is the registry number for Methyl 2-amino-4-phenylbenzoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 2-amino-4-phenylbenzoate (CAS 800375-15-9) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: methyl 2-amino-4-phenylbenzoate. InChIKey: VFGHBOADZPXLKY-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | methyl 2-amino-4-phenylbenzoate |
| InChIKey | VFGHBOADZPXLKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)