Products 802052-63-7
CAS 802052-63-7 appears in our catalog under these names: 3-Phenyl-1h-pyrrole-2-carboxylic acid, 95%, 3-phenyl-1H-pyrrole-2-carboxylic acid, >95% (HPLC), 3-Phenyl-1H-pyrrole-2-carboxylic Acid, 3-Phenyl-1H-pyrrole-2-carboxylic Acid, >95%, >95%. Offered by: Combi-blocks, TRC, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg, 0,5g.
3-phenyl-1H-pyrrole-2-carboxylic acid (CAS 802052-63-7) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 3-phenyl-1H-pyrrole-2-carboxylic acid. InChIKey: JKPQOHQTACWXPF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 3-phenyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | JKPQOHQTACWXPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC=C2)C(=O)O |
Computed by PubChem (NCBI)