CAS 80547-66-6 is the registry number for 3-Amino-5-hydroxy-4-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-5-hydroxy-4-methoxybenzoic acid (CAS 80547-66-6) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 3-amino-5-hydroxy-4-methoxybenzoic acid. InChIKey: SSIDFDGMYIYYBS-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3-amino-5-hydroxy-4-methoxybenzoic acid |
| InChIKey | SSIDFDGMYIYYBS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1O)C(=O)O)N |
Computed by PubChem (NCBI)