CAS 80751-52-6 is the registry number for FURAN-2-CARBOXYLIC ACID N-HYDROXYSUCCIN&. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.
(2,5-dioxopyrrolidin-1-yl) furan-2-carboxylate (CAS 80751-52-6) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) furan-2-carboxylate. InChIKey: GVUSKKBAJHAFND-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) furan-2-carboxylate |
| InChIKey | GVUSKKBAJHAFND-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)