CAS 80787-43-5 appears in our catalog under these names: Benzyl 3-aminobenzoate, 95%, Benzyl 3-aminobenzoate, Benzyl 3-aminobenzoate, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g, 2,5g.
Benzyl 3-aminobenzoate (CAS 80787-43-5) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: benzyl 3-aminobenzoate. InChIKey: YQEQHIZMMDWDOV-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | benzyl 3-aminobenzoate |
| InChIKey | YQEQHIZMMDWDOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)