CAS 808148-30-3 is the registry number for 8-Desmethyleleutherin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (CAS 808148-30-3) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: (1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione. InChIKey: PPEBHGFEKAUPBT-JGVFFNPUSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (1R,3S)-9-hydroxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| InChIKey | PPEBHGFEKAUPBT-JGVFFNPUSA-N |
| SMILES | C[C@H]1CC2=C([C@H](O1)C)C(=O)C3=C(C2=O)C=CC=C3O |
Computed by PubChem (NCBI)