CAS 80819-65-4 appears in our catalog under these names: 1-Benzyl-1H-1,2,3-triazole-4-carboxamide, Rufinamide Impurity 6, 2,6-Didesfluoro Rufinamide, Rufinamide impurity 1. Offered by: Biosynth, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 1g, 100mg, on request, 25mg, Get quote.
1-benzyltriazole-4-carboxamide (CAS 80819-65-4) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 1-benzyltriazole-4-carboxamide. InChIKey: ZFOPXDQZNYULBK-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 1-benzyltriazole-4-carboxamide |
| InChIKey | ZFOPXDQZNYULBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=N2)C(=O)N |
Computed by PubChem (NCBI)