CAS 80924-06-7 appears in our catalog under these names: (R)-1-((2S,4R,5R)-5-Hydroxy-2-phenyl-1,3-dioxan-4-yl)ethane-1,2-diol, 98%, 1,3-o-(S)-Benzylidene-D-arabitol. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(1R)-1-[(2S,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]ethane-1,2-diol (CAS 80924-06-7) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: (1R)-1-[(2S,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]ethane-1,2-diol. InChIKey: IENSYSQTQGXKIV-KKOKHZNYSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (1R)-1-[(2S,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]ethane-1,2-diol |
| InChIKey | IENSYSQTQGXKIV-KKOKHZNYSA-N |
| SMILES | C1[C@H]([C@H](O[C@H](O1)C2=CC=CC=C2)[C@@H](CO)O)O |
Computed by PubChem (NCBI)