Products 80953-32-8
CAS 80953-32-8 is the registry number for 3,4,5,6-Tetra-O-acetyl-D-myo-inositol. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
[(1S,2R,3R,4S,5R,6S)-2,3,4-triacetyloxy-5,6-dihydroxycyclohexyl] acetate (CAS 80953-32-8) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(1S,2R,3R,4S,5R,6S)-2,3,4-triacetyloxy-5,6-dihydroxycyclohexyl] acetate. InChIKey: ZQLBHQSQMQLFBM-XNBXPENISA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(1S,2R,3R,4S,5R,6S)-2,3,4-triacetyloxy-5,6-dihydroxycyclohexyl] acetate |
| InChIKey | ZQLBHQSQMQLFBM-XNBXPENISA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@@H]([C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C)O)O |
Computed by PubChem (NCBI)