Products 35939-71-0
CAS 35939-71-0 is the registry number for Methyl 2,4,6-tri-O-methyl-a-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
(2S,3R,4S,5S,6R)-2,3,5-trimethoxy-6-(methoxymethyl)oxan-4-ol (CAS 35939-71-0) is a chemical compound with the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2,3,5-trimethoxy-6-(methoxymethyl)oxan-4-ol. InChIKey: HJHDQMLCKFWWDV-ZOZBQHSOSA-N.
| Molecular formula | C10H20O6 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2,3,5-trimethoxy-6-(methoxymethyl)oxan-4-ol |
| InChIKey | HJHDQMLCKFWWDV-ZOZBQHSOSA-N |
| SMILES | COC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC)OC)O)OC |
Computed by PubChem (NCBI)