CAS 810680-55-8 is the registry number for 7-Chloro-2,3-dihydrobenzo[b][1,4]dioxine-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde (CAS 810680-55-8) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde. InChIKey: XLDUGBODKAFVLO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde |
| InChIKey | XLDUGBODKAFVLO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2O1)Cl)C=O |
Computed by PubChem (NCBI)