CAS 81122-69-2 is the registry number for 4-bromo-3-(hydroxymethyl)-2-methyl-1-phenyl-3-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 10g, 25g.
4-bromo-5-(hydroxymethyl)-1-methyl-2-phenylpyrazol-3-one (CAS 81122-69-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 4-bromo-5-(hydroxymethyl)-1-methyl-2-phenylpyrazol-3-one. InChIKey: PINQJWLHQPEMAX-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 4-bromo-5-(hydroxymethyl)-1-methyl-2-phenylpyrazol-3-one |
| InChIKey | PINQJWLHQPEMAX-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N1C2=CC=CC=C2)Br)CO |
Computed by PubChem (NCBI)