CAS 811812-99-4 is the registry number for 2-Methyl-4-(4h-1,2,4-triazol-4-yl)phenol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-methyl-4-(1,2,4-triazol-4-yl)phenol (CAS 811812-99-4) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 2-methyl-4-(1,2,4-triazol-4-yl)phenol. InChIKey: PUJJVDBUVWMXOJ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 2-methyl-4-(1,2,4-triazol-4-yl)phenol |
| InChIKey | PUJJVDBUVWMXOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C=NN=C2)O |
Computed by PubChem (NCBI)