CAS 81198-25-6 is the registry number for 1-(2,4-Dichlorophenyl)-3-methyl-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,4-dichlorophenyl)-5-methylpyrazol-3-amine (CAS 81198-25-6) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-5-methylpyrazol-3-amine. InChIKey: JWTJFVJUYHZYCH-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-5-methylpyrazol-3-amine |
| InChIKey | JWTJFVJUYHZYCH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)