Products 81202-00-8
CAS 81202-00-8 is the registry number for L-Glutamic acid-5-13C, 98.0%. Offered by: MedChemExpress. Available pack sizes: 5 mg.
(2S)-2-amino(513C)pentanedioic acid (CAS 81202-00-8) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 148.12 g/mol. IUPAC name: (2S)-2-amino(513C)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-MYXYCAHRSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (2S)-2-amino(513C)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-MYXYCAHRSA-N |
| SMILES | C(C[13C](=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)