Products 81224-14-8

CAS 81224-14-8 is the registry number for Methyl 7-bromo-4-methoxy-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 7-bromo-4-methoxy-1H-indole-2-carboxylate (CAS 81224-14-8) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: methyl 7-bromo-4-methoxy-1H-indole-2-carboxylate. InChIKey: XTTAVMSLGSKAMR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10BrNO3
Molecular weight284.11 g/mol
IUPAC namemethyl 7-bromo-4-methoxy-1H-indole-2-carboxylate
InChIKeyXTTAVMSLGSKAMR-UHFFFAOYSA-N
SMILESCOC1=C2C=C(NC2=C(C=C1)Br)C(=O)OC

Computed by PubChem (NCBI)