Products 81256-11-3
CAS 81256-11-3 is the registry number for N-(2-hydroxy-5-methylphenyl)-4-methylbenzenesulfonamide, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(2-hydroxy-5-methylphenyl)-4-methylbenzenesulfonamide (CAS 81256-11-3) is a chemical compound with the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. IUPAC name: N-(2-hydroxy-5-methylphenyl)-4-methylbenzenesulfonamide. InChIKey: GPUGAPONHYNNRQ-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | N-(2-hydroxy-5-methylphenyl)-4-methylbenzenesulfonamide |
| InChIKey | GPUGAPONHYNNRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=CC(=C2)C)O |
Computed by PubChem (NCBI)