CAS 812700-19-9 appears in our catalog under these names: 3-(2,2-Difluoroethoxy)benzoic acid, 97%, 3-(2,2-Difluoroethoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(2,2-difluoroethoxy)benzoic acid (CAS 812700-19-9) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 3-(2,2-difluoroethoxy)benzoic acid. InChIKey: VNUDXYRBOOGWJL-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 3-(2,2-difluoroethoxy)benzoic acid |
| InChIKey | VNUDXYRBOOGWJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)F)C(=O)O |
Computed by PubChem (NCBI)