CAS 81273-81-6 appears in our catalog under these names: Lactate–13C sodium, SODIUM L- LACTATE-1-13C SOLUTION (45-55&, Sodium l-lactate-1-13c, 98%, 98%. Offered by: GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 50mg (1,77M * 250μl in water), 100mg (1,77M * 500μl in water), 1G, 50mg.
Sodium (2S)-2-hydroxy(113C)propanoate (CAS 81273-81-6) is a chemical compound with the molecular formula C3H5NaO3 and a molecular weight of 113.05 g/mol. IUPAC name: sodium (2S)-2-hydroxy(113C)propanoate. InChIKey: NGSFWBMYFKHRBD-FWGDTYFGSA-M.
| Molecular formula | C3H5NaO3 |
|---|---|
| Molecular weight | 113.05 g/mol |
| IUPAC name | sodium (2S)-2-hydroxy(113C)propanoate |
| InChIKey | NGSFWBMYFKHRBD-FWGDTYFGSA-M |
| SMILES | C[C@@H]([13C](=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)