Products 81307-24-6
CAS 81307-24-6 is the registry number for Antibiotic DC 81. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (CAS 81307-24-6) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 3-hydroxy-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one. InChIKey: LQDGLTOVYOUCRG-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 3-hydroxy-2-methoxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| InChIKey | LQDGLTOVYOUCRG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)N3CCCC3C=N2)O |
Computed by PubChem (NCBI)