Products 81438-55-3
CAS 81438-55-3 is the registry number for 2,5,7-Trimethylimidazo[1,2-a]pyridine-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5,7-trimethylimidazo[1,2-a]pyridine-3-carboxylic acid (CAS 81438-55-3) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 2,5,7-trimethylimidazo[1,2-a]pyridine-3-carboxylic acid. InChIKey: ACKZNCSFLVGLCA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2,5,7-trimethylimidazo[1,2-a]pyridine-3-carboxylic acid |
| InChIKey | ACKZNCSFLVGLCA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C(=C1)C)C(=O)O)C |
Computed by PubChem (NCBI)