CAS 81585-78-6 is the registry number for Fenclofenac Methyl Ester. Offered by: TRC, Mikromol. Available pack sizes: 1g, 100mg.
Methyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate (CAS 81585-78-6) is a chemical compound with the molecular formula C15H12Cl2O3 and a molecular weight of 311.2 g/mol. IUPAC name: methyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate. InChIKey: IXKUOZXRLGQKKQ-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | methyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate |
| InChIKey | IXKUOZXRLGQKKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=CC=C1OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)