Products 81593-54-6
CAS 81593-54-6 appears in our catalog under these names: MEAI (hydrochloride), 5-Methoxy-2,3-dihydro-1H-inden-2-amine hydrochloride, MEAI (hydrochloride), 95.0%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 25mg, 10 mg, 5 mg, 1 mg.
5-methoxy-2,3-dihydro-1H-inden-2-amine;hydrochloride (CAS 81593-54-6) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 5-methoxy-2,3-dihydro-1H-inden-2-amine;hydrochloride. InChIKey: UXHKKYAVZDAYIG-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 5-methoxy-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| InChIKey | UXHKKYAVZDAYIG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(C2)N)C=C1.Cl |
Computed by PubChem (NCBI)
Synonyms:
Chaperon hydrochloride, 5-methoxy-2,3-dihydro-1H-inden-2-amine hydrochloride, MEAI (hydrochloride), Meai HCl, 5-methoxyindan-2-ylamine hydrochloride, 5-Meo-ai HCl, 5-Methoxy-2-aminoindane hydrochloride, 5-methoxy-2,3-dihydro-1H-inden-2-amine;hydrochloride, 2-Indanamine, 5-methoxy-, hydrochloride, 5-methoxy-2,3-dihydro-1H-inden-2-amine HCl