CAS 816448-09-6 appears in our catalog under these names: 8-Methylquinoline-4-carboxylic acid, 95%, 8-Methylquinoline-4-carboxylic acid, 97%, 8–Methylquinoline–4–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 25g, 10g.
8-methylquinoline-4-carboxylic acid (CAS 816448-09-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 8-methylquinoline-4-carboxylic acid. InChIKey: QHMYOJAIEQCUQX-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 8-methylquinoline-4-carboxylic acid |
| InChIKey | QHMYOJAIEQCUQX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC=N2)C(=O)O |
Computed by PubChem (NCBI)