CAS 81660-73-3 appears in our catalog under these names: tert–Butyl isonicotinate, tert-Butyl isonicotinate 97%, tert-Butyl isonicotinate, 97%, 97%, tert-Butyl isonicotinate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g, 100g, 10g, 50g.
Tert-butyl pyridine-4-carboxylate (CAS 81660-73-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: tert-butyl pyridine-4-carboxylate. InChIKey: ZXAPIQZSJHLLDS-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | tert-butyl pyridine-4-carboxylate |
| InChIKey | ZXAPIQZSJHLLDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)