CAS 81677-60-3 is the registry number for (S)-Methyl 2-amino-3-(4-nitrophenyl)propanoate, 96%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate (CAS 81677-60-3) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate. InChIKey: FUFUQQWIXMPZFU-VIFPVBQESA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate |
| InChIKey | FUFUQQWIXMPZFU-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)