Products 817553-80-3

CAS 817553-80-3 is the registry number for Benzylpenicillin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-3-oxo-2-[(2-phenylacetyl)amino]propanoic acid (CAS 817553-80-3) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: (2S)-3-oxo-2-[(2-phenylacetyl)amino]propanoic acid. InChIKey: MCIGTZUNWOGATJ-VIFPVBQESA-N.

Identity
Molecular formulaC11H11NO4
Molecular weight221.21 g/mol
IUPAC name(2S)-3-oxo-2-[(2-phenylacetyl)amino]propanoic acid
InChIKeyMCIGTZUNWOGATJ-VIFPVBQESA-N
SMILESC1=CC=C(C=C1)CC(=O)N[C@@H](C=O)C(=O)O

Computed by PubChem (NCBI)