CAS 81880-27-5 appears in our catalog under these names: 1-(4-Chlorophenyl)-2-methylbutan-1-amine, 95%, 1-(4-Chlorophenyl)-2-methylbutan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(4-chlorophenyl)-2-methylbutan-1-amine (CAS 81880-27-5) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-methylbutan-1-amine. InChIKey: WHVMBRDHYOGMIZ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-methylbutan-1-amine |
| InChIKey | WHVMBRDHYOGMIZ-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C1=CC=C(C=C1)Cl)N |
Computed by PubChem (NCBI)