CAS 82-57-5 appears in our catalog under these names: Visnagin, 99%, Visnagin, Visnagin/ 99.87% (existing batch purity), Visnagin 99%, 4-Methoxy-7-methyl-5H-furo[3,2-g]chromen-5-one, 99%, 99%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 25mg, 50mg, 1g, 100mg, 500mg, 25g, 10g, 50g.
4-methoxy-7-methylfuro[3,2-g]chromen-5-one (CAS 82-57-5) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 4-methoxy-7-methylfuro[3,2-g]chromen-5-one. InChIKey: NZVQLVGOZRELTG-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-methoxy-7-methylfuro[3,2-g]chromen-5-one |
| InChIKey | NZVQLVGOZRELTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C=C3C(=C2OC)C=CO3 |
Computed by PubChem (NCBI)