CAS 82027-57-4 appears in our catalog under these names: 2-Phenyl-2-(2,2,2-trifluoroethoxy)acetic acid, 95%, 2-Phenyl-2-(2,2,2-trifluoroethoxy)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid (CAS 82027-57-4) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid. InChIKey: LEPUWBXPJLLGGA-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-phenyl-2-(2,2,2-trifluoroethoxy)acetic acid |
| InChIKey | LEPUWBXPJLLGGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)