CAS 82261-41-4 appears in our catalog under these names: 1-(4-Cyanophenyl)-3,3-dimethylurea, 95%, 3-(4-Cyanophenyl)-1,1-dimethylurea, 95-<97%. Offered by: AmBeed, Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
3-(4-cyanophenyl)-1,1-dimethylurea (CAS 82261-41-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 3-(4-cyanophenyl)-1,1-dimethylurea. InChIKey: RUQIHUKZFGRXLO-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(4-cyanophenyl)-1,1-dimethylurea |
| InChIKey | RUQIHUKZFGRXLO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)