CAS 824429-50-7 is the registry number for N-(6-Hydroxy-pyridin-2-yl)-2,2-dimethyl-propionamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,2-dimethyl-N-(6-oxo-1H-pyridin-2-yl)propanamide (CAS 824429-50-7) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 2,2-dimethyl-N-(6-oxo-1H-pyridin-2-yl)propanamide. InChIKey: HZMZDHXEFCTHBD-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2,2-dimethyl-N-(6-oxo-1H-pyridin-2-yl)propanamide |
| InChIKey | HZMZDHXEFCTHBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC(=O)N1 |
Computed by PubChem (NCBI)