CAS 82462-36-0 appears in our catalog under these names: 6β–Ethoxyfuranoeremophilane, 6β-Ethoxyfuranoeremophilane. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4S,4aR,5S,8aR)-4-ethoxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran (CAS 82462-36-0) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: (4S,4aR,5S,8aR)-4-ethoxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran. InChIKey: FFUWAMHKUYRIBZ-NSNWQYSKSA-N.
| Molecular formula | C17H26O2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | (4S,4aR,5S,8aR)-4-ethoxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran |
| InChIKey | FFUWAMHKUYRIBZ-NSNWQYSKSA-N |
| SMILES | CCO[C@@H]1C2=C(C[C@@H]3[C@]1([C@H](CCC3)C)C)OC=C2C |
Computed by PubChem (NCBI)